CAS 14344-48-0 appears in our catalog under these names: L,L-Ethylenedicysteine, (L,L)-Ethylenedicysteine, Ethylenedicysteine 90%, (2R,2'R)-2,2'-(Ethane-1,2-diylbis(azanediyl))bis(3-mercaptopropanoic acid), 90%, 90%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
(2R)-2-[2-[[(1R)-1-carboxy-2-sulfanylethyl]amino]ethylamino]-3-sulfanylpropanoic acid (CAS 14344-48-0) is a chemical compound with the molecular formula C8H16N2O4S2 and a molecular weight of 268.4 g/mol. IUPAC name: (2R)-2-[2-[[(1R)-1-carboxy-2-sulfanylethyl]amino]ethylamino]-3-sulfanylpropanoic acid. InChIKey: BQHFYSWNHZMMDO-WDSKDSINSA-N.
| Molecular formula | C8H16N2O4S2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (2R)-2-[2-[[(1R)-1-carboxy-2-sulfanylethyl]amino]ethylamino]-3-sulfanylpropanoic acid |
| InChIKey | BQHFYSWNHZMMDO-WDSKDSINSA-N |
| SMILES | C(CN[C@@H](CS)C(=O)O)N[C@@H](CS)C(=O)O |
Computed by PubChem (NCBI)