CAS 18840-45-4 is the registry number for L-Cysteine-D-penicillamine Disulfide, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
(2S)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-3-methylbutanoic acid (CAS 18840-45-4) is a chemical compound with the molecular formula C8H16N2O4S2 and a molecular weight of 268.4 g/mol. IUPAC name: (2S)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-3-methylbutanoic acid. InChIKey: BOTADXJBFXFSLA-WHFBIAKZSA-N.
| Molecular formula | C8H16N2O4S2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (2S)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-3-methylbutanoic acid |
| InChIKey | BOTADXJBFXFSLA-WHFBIAKZSA-N |
| SMILES | CC(C)([C@H](C(=O)O)N)SSC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)