CAS 462-10-2 appears in our catalog under these names: 4,4'–Disulfanediylbis(2–aminobutanoic acid), 4,4'-Disulfanediylbis(2-aminobutanoic acid)/ 98%, 4,4'-Disulfanediylbis(2-aminobutanoic acid), 95.0%, 4,4'-Disulfanediylbis(2-aminobutanoic acid) (Standard), 4,4'-Disulfanediylbis(2-aminobutanoic acid), 95%, 95%. Offered by: GLPBio, TargetMol, MedChemExpress, Chemat, Chemat Brand. Available pack sizes: 5g, 1g, 5 g, Get quote, 10g, 25g, 100g, on request.
2-amino-4-[(3-amino-3-carboxypropyl)disulfanyl]butanoic acid (CAS 462-10-2) is a chemical compound with the molecular formula C8H16N2O4S2 and a molecular weight of 268.4 g/mol. IUPAC name: 2-amino-4-[(3-amino-3-carboxypropyl)disulfanyl]butanoic acid. InChIKey: ZTVZLYBCZNMWCF-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O4S2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 2-amino-4-[(3-amino-3-carboxypropyl)disulfanyl]butanoic acid |
| InChIKey | ZTVZLYBCZNMWCF-UHFFFAOYSA-N |
| SMILES | C(CSSCCC(C(=O)O)N)C(C(=O)O)N |
Computed by PubChem (NCBI)