Products 1086429-87-9
CAS 1086429-87-9 appears in our catalog under these names: 2-Bromo-3-(bromomethyl)benzonitrile, 95%, 2-Bromo-3-bromomethyl-benzonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
2-bromo-3-(bromomethyl)benzonitrile (CAS 1086429-87-9) is a chemical compound with the molecular formula C8H5Br2N and a molecular weight of 274.94 g/mol. IUPAC name: 2-bromo-3-(bromomethyl)benzonitrile. InChIKey: SZLJWMUBSCYTLD-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2N |
|---|---|
| Molecular weight | 274.94 g/mol |
| IUPAC name | 2-bromo-3-(bromomethyl)benzonitrile |
| InChIKey | SZLJWMUBSCYTLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C#N)Br)CBr |
Computed by PubChem (NCBI)