Products 1243536-87-9
CAS 1243536-87-9 is the registry number for 2-Bromo-6-(bromomethyl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-bromo-6-(bromomethyl)benzonitrile (CAS 1243536-87-9) is a chemical compound with the molecular formula C8H5Br2N and a molecular weight of 274.94 g/mol. IUPAC name: 2-bromo-6-(bromomethyl)benzonitrile. InChIKey: LYNUURAMENQBRI-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2N |
|---|---|
| Molecular weight | 274.94 g/mol |
| IUPAC name | 2-bromo-6-(bromomethyl)benzonitrile |
| InChIKey | LYNUURAMENQBRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C#N)CBr |
Computed by PubChem (NCBI)