CAS 1240045-42-4 is the registry number for 2,5-Dibromo-1H-indole, 97%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g.
2,5-dibromo-1H-indole (CAS 1240045-42-4) is a chemical compound with the molecular formula C8H5Br2N and a molecular weight of 274.94 g/mol. IUPAC name: 2,5-dibromo-1H-indole. InChIKey: RXDCCNFVFWNQLN-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2N |
|---|---|
| Molecular weight | 274.94 g/mol |
| IUPAC name | 2,5-dibromo-1H-indole |
| InChIKey | RXDCCNFVFWNQLN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(N2)Br |
Computed by PubChem (NCBI)