CAS 854923-38-9 appears in our catalog under these names: 5,6-Dibromo-1h-indole, 95%, 5,6–Dibromo–1H–indole, 5,6-dibromo-1H-indole, 5,6-Dibromo-1H-indole, 97%, 97%, 5,6-Dibromo-1H-indole, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg.
5,6-dibromo-1H-indole (CAS 854923-38-9) is a chemical compound with the molecular formula C8H5Br2N and a molecular weight of 274.94 g/mol. IUPAC name: 5,6-dibromo-1H-indole. InChIKey: RXYMGJXOXIECHX-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2N |
|---|---|
| Molecular weight | 274.94 g/mol |
| IUPAC name | 5,6-dibromo-1H-indole |
| InChIKey | RXYMGJXOXIECHX-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)Br)Br |
Computed by PubChem (NCBI)