CAS 869950-23-2 appears in our catalog under these names: 5-(2,4-Dimethylphenoxymethyl)furan-2-carboxylic acid, 95%, 5-((2,4-Dimethylphenoxy)methyl)furan-2-carboxylic acid, 97%, 5-(2,4-Dimethylphenoxymethyl)furan-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
5-[(2,4-dimethylphenoxy)methyl]furan-2-carboxylic acid (CAS 869950-23-2) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 5-[(2,4-dimethylphenoxy)methyl]furan-2-carboxylic acid. InChIKey: KZDVFUFFQYJIED-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 5-[(2,4-dimethylphenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | KZDVFUFFQYJIED-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC2=CC=C(O2)C(=O)O)C |
Computed by PubChem (NCBI)