CAS 162107-48-4 is the registry number for (R)-tert-Butyl 4-ethynyl-2,2-dimethyloxazolidine-3-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (4R)-4-ethynyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 162107-48-4) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl (4R)-4-ethynyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: DPZQSYOKTUMHNY-SECBINFHSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl (4R)-4-ethynyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | DPZQSYOKTUMHNY-SECBINFHSA-N |
| SMILES | CC1(N([C@@H](CO1)C#C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)