CAS 1087160-01-7 appears in our catalog under these names: 5-Bromo-1-(phenylmethyl)-1h-indazole, 95%, 1-Benzyl-5-bromo-1H-indazole 95%, 5-Bromo-1-(phenylmethyl)-1H-indazole. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
1-benzyl-5-bromoindazole (CAS 1087160-01-7) is a chemical compound with the molecular formula C14H11BrN2 and a molecular weight of 287.15 g/mol. IUPAC name: 1-benzyl-5-bromoindazole. InChIKey: KTTCZZNCIPVXKX-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | 1-benzyl-5-bromoindazole |
| InChIKey | KTTCZZNCIPVXKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Br)C=N2 |
Computed by PubChem (NCBI)