CAS 419557-42-9 appears in our catalog under these names: 2-(3-Bromophenyl)-6-methylimidazo[1,2-a]pyridine, 95%, 2-(3-Bromophenyl)-6-methylimidazo[1,2-a]pyridine, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(3-bromophenyl)-6-methylimidazo[1,2-a]pyridine (CAS 419557-42-9) is a chemical compound with the molecular formula C14H11BrN2 and a molecular weight of 287.15 g/mol. IUPAC name: 2-(3-bromophenyl)-6-methylimidazo[1,2-a]pyridine. InChIKey: VUKLHKSSQCTIKR-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | 2-(3-bromophenyl)-6-methylimidazo[1,2-a]pyridine |
| InChIKey | VUKLHKSSQCTIKR-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)