CAS 838-32-4 appears in our catalog under these names: 2-(4-Bromophenyl)-7-methylimidazo[1,2-a]pyridine, 95%, 2-(4-BROMOPHENYL)-7-METHYLIMIDAZO[1,2-A]PYRIDINE, 98%, 98%, 2-(4-Bromophenyl)-7-methylimidazo[1,2-a]pyridine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
2-(4-bromophenyl)-7-methylimidazo[1,2-a]pyridine (CAS 838-32-4) is a chemical compound with the molecular formula C14H11BrN2 and a molecular weight of 287.15 g/mol. IUPAC name: 2-(4-bromophenyl)-7-methylimidazo[1,2-a]pyridine. InChIKey: AFYSTHGPBTXVDY-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | 2-(4-bromophenyl)-7-methylimidazo[1,2-a]pyridine |
| InChIKey | AFYSTHGPBTXVDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CN2C=C1)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)