Products 726155-36-8

CAS 726155-36-8 is the registry number for 2-(3-Bromophenyl)-8-methylimidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-bromophenyl)-8-methylimidazo[1,2-a]pyridine (CAS 726155-36-8) is a chemical compound with the molecular formula C14H11BrN2 and a molecular weight of 287.15 g/mol. IUPAC name: 2-(3-bromophenyl)-8-methylimidazo[1,2-a]pyridine. InChIKey: JAZCTBFIKVNRFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BrN2
Molecular weight287.15 g/mol
IUPAC name2-(3-bromophenyl)-8-methylimidazo[1,2-a]pyridine
InChIKeyJAZCTBFIKVNRFZ-UHFFFAOYSA-N
SMILESCC1=CC=CN2C1=NC(=C2)C3=CC(=CC=C3)Br

Computed by PubChem (NCBI)