CAS 1087605-28-4 appears in our catalog under these names: 2-(2-(4-Chlorophenyl)-4-methyl-6-oxo-1,6-dihydropyrimidin-5-yl)acetic acid, 95%, 2-(2-(4-Chlorophenyl)-4-methyl-6-oxo-1,6-dihydropyrimidin-5-yl)acetic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-[2-(4-chlorophenyl)-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid (CAS 1087605-28-4) is a chemical compound with the molecular formula C13H11ClN2O3 and a molecular weight of 278.69 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid. InChIKey: WNWBVJWEGQWKIC-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O3 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid |
| InChIKey | WNWBVJWEGQWKIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=N1)C2=CC=C(C=C2)Cl)CC(=O)O |
Computed by PubChem (NCBI)