CAS 1087751-63-0 appears in our catalog under these names: (S)–2–Amino–3–(quinolin–2–yl)propanoic acid hydrochloride, (S)-2-Amino-3-(quinolin-2-yl)propanoic acid hydrochloride, 98%, 98%, (S)-2-Amino-3-(quinolin-2-yl)propanoic acid hydrochloride, 98%, (S)-2-AMINO-3-QUINOLIN-2-YL-PROPIONIC ACID DIHYDROCHLORIDE, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-3-quinolin-2-ylpropanoic acid;hydrochloride (CAS 1087751-63-0) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: (2S)-2-amino-3-quinolin-2-ylpropanoic acid;hydrochloride. InChIKey: FXQMKKMNLQZEMJ-PPHPATTJSA-N.
| Molecular formula | C12H13ClN2O2 |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | (2S)-2-amino-3-quinolin-2-ylpropanoic acid;hydrochloride |
| InChIKey | FXQMKKMNLQZEMJ-PPHPATTJSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)