CAS 1087792-09-3 is the registry number for 5-Chloro-2-((furan-2-ylmethyl)amino)pyrimidine-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 10g.
5-chloro-2-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid (CAS 1087792-09-3) is a chemical compound with the molecular formula C10H8ClN3O3 and a molecular weight of 253.64 g/mol. IUPAC name: 5-chloro-2-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid. InChIKey: OIGSTMMHDNRYPP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O3 |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | 5-chloro-2-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid |
| InChIKey | OIGSTMMHDNRYPP-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=NC=C(C(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)