CAS 2055852-91-8 appears in our catalog under these names: 4-(6-chloro-5-nitropyridin-2-yl)-3,5-dimethylisoxazole, 95%, 95%, 2-Chloro-6-(3,5-dimethyl-4-isoxazolyl)-3-nitropyridine, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 500mg.
4-(6-chloro-5-nitro-2-pyridinyl)-3,5-dimethyl-1,2-oxazole (CAS 2055852-91-8) is a chemical compound with the molecular formula C10H8ClN3O3 and a molecular weight of 253.64 g/mol. IUPAC name: 4-(6-chloro-5-nitro-2-pyridinyl)-3,5-dimethyl-1,2-oxazole. InChIKey: AMJYMEONPQVBNP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O3 |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | 4-(6-chloro-5-nitro-2-pyridinyl)-3,5-dimethyl-1,2-oxazole |
| InChIKey | AMJYMEONPQVBNP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=NC(=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)