Products 2089319-30-0
CAS 2089319-30-0 is the registry number for 4-Chloro-7-methoxy-2-methyl-6-nitroquinazoline 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-chloro-7-methoxy-2-methyl-6-nitroquinazoline (CAS 2089319-30-0) is a chemical compound with the molecular formula C10H8ClN3O3 and a molecular weight of 253.64 g/mol. IUPAC name: 4-chloro-7-methoxy-2-methyl-6-nitroquinazoline. InChIKey: HKYHQOUKKDNLLA-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O3 |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | 4-chloro-7-methoxy-2-methyl-6-nitroquinazoline |
| InChIKey | HKYHQOUKKDNLLA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2C(=N1)Cl)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)