Products 2378265-71-3

CAS 2378265-71-3 is the registry number for Ethyl 2-chloro-7-formylpyrrolo[2,1-f][1,2,4]triazine-4-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-chloro-7-formylpyrrolo[2,1-f][1,2,4]triazine-4-carboxylate (CAS 2378265-71-3) is a chemical compound with the molecular formula C10H8ClN3O3 and a molecular weight of 253.64 g/mol. IUPAC name: ethyl 2-chloro-7-formylpyrrolo[2,1-f][1,2,4]triazine-4-carboxylate. InChIKey: CJXIVWAUMJVSGE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClN3O3
Molecular weight253.64 g/mol
IUPAC nameethyl 2-chloro-7-formylpyrrolo[2,1-f][1,2,4]triazine-4-carboxylate
InChIKeyCJXIVWAUMJVSGE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=NN2C1=CC=C2C=O)Cl

Computed by PubChem (NCBI)