CAS 1087792-43-5 is the registry number for 3-Chloro-5-phenyl-4-(propan-2-yl)-4H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-chloro-5-phenyl-4-propan-2-yl-1,2,4-triazole (CAS 1087792-43-5) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: 3-chloro-5-phenyl-4-propan-2-yl-1,2,4-triazole. InChIKey: LNJVYAJPRZHFJW-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 3-chloro-5-phenyl-4-propan-2-yl-1,2,4-triazole |
| InChIKey | LNJVYAJPRZHFJW-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=NN=C1Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)