Products 1087798-05-7
CAS 1087798-05-7 is the registry number for 2,2,2-Trifluoroethyl N-(2,3-dihydro-1H-inden-5-yl)carbamate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,2,2-trifluoroethyl N-(2,3-dihydro-1H-inden-5-yl)carbamate (CAS 1087798-05-7) is a chemical compound with the molecular formula C12H12F3NO2 and a molecular weight of 259.22 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2,3-dihydro-1H-inden-5-yl)carbamate. InChIKey: BGOFCGWDLXNOGC-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO2 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2,3-dihydro-1H-inden-5-yl)carbamate |
| InChIKey | BGOFCGWDLXNOGC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)