Products 782-94-5
CAS 782-94-5 appears in our catalog under these names: 2,2,2-Trifluoroethyl 4-chlorophenylcarbamate, 95%, 2,2,2-Trifluoroethyl (4-chlorophenyl)carbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,2,2-trifluoroethyl N-(4-chlorophenyl)carbamate (CAS 782-94-5) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(4-chlorophenyl)carbamate. InChIKey: XRRXDEMRTNDOQJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(4-chlorophenyl)carbamate |
| InChIKey | XRRXDEMRTNDOQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)OCC(F)(F)F)Cl |
Computed by PubChem (NCBI)