Products 338422-79-0

CAS 338422-79-0 is the registry number for 3-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanoic acid (CAS 338422-79-0) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanoic acid. InChIKey: FFAQNTURDIPVTO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClF3NO2
Molecular weight253.60 g/mol
IUPAC name3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanoic acid
InChIKeyFFAQNTURDIPVTO-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Cl)CCC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)