CAS 1088-08-0 appears in our catalog under these names: 3-Phenyl-1-(2,4,6-trihydroxyphenyl)propan-1-one, 98%, 2',4',6'-Trihydroxydihydrochalcone. Offered by: AmBeed, Biosynth. Available pack sizes: 1mg, 100mg, 50mg, 250mg, 500mg, 1000mg.
3-phenyl-1-(2,4,6-trihydroxyphenyl)propan-1-one (CAS 1088-08-0) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-phenyl-1-(2,4,6-trihydroxyphenyl)propan-1-one. InChIKey: QWQGMMRHTWIOGH-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-phenyl-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| InChIKey | QWQGMMRHTWIOGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2O)O)O |
Computed by PubChem (NCBI)