CAS 1088236-42-3 is the registry number for H-L-Tyr(3,5-Me2)-OH*HCl. Offered by: Iris Biotech. Available pack sizes: 1g, 250mg.
(2S)-2-amino-3-(4-hydroxy-3,5-dimethylphenyl)propanoic acid (CAS 1088236-42-3) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxy-3,5-dimethylphenyl)propanoic acid. InChIKey: DFQINAKFXBIFHG-VIFPVBQESA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxy-3,5-dimethylphenyl)propanoic acid |
| InChIKey | DFQINAKFXBIFHG-VIFPVBQESA-N |
| SMILES | CC1=CC(=CC(=C1O)C)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)