CAS 1089276-04-9 is the registry number for (R)-4-Methylhomophenylalanine, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(2R)-2-amino-4-(4-methylphenyl)butanoic acid (CAS 1089276-04-9) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2R)-2-amino-4-(4-methylphenyl)butanoic acid. InChIKey: QHABQGXRISWAEZ-SNVBAGLBSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2R)-2-amino-4-(4-methylphenyl)butanoic acid |
| InChIKey | QHABQGXRISWAEZ-SNVBAGLBSA-N |
| SMILES | CC1=CC=C(C=C1)CC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)