CAS 709609-35-8 appears in our catalog under these names: (S)-4-Methylhomophenylalanine, 95%, (S)-4-Methylhomophenylalanine. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
(2S)-2-amino-4-(4-methylphenyl)butanoic acid (CAS 709609-35-8) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2S)-2-amino-4-(4-methylphenyl)butanoic acid. InChIKey: QHABQGXRISWAEZ-JTQLQIEISA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2S)-2-amino-4-(4-methylphenyl)butanoic acid |
| InChIKey | QHABQGXRISWAEZ-JTQLQIEISA-N |
| SMILES | CC1=CC=C(C=C1)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)