CAS 108932-41-8 appears in our catalog under these names: 2-(Thiophen-3-yl)phenol, 95%, 2-(Thiophen-3-yl)phenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
2-thiophen-3-ylphenol (CAS 108932-41-8) is a chemical compound with the molecular formula C10H8OS and a molecular weight of 176.24 g/mol. IUPAC name: 2-thiophen-3-ylphenol. InChIKey: VCRSXSFOKOVCRV-UHFFFAOYSA-N.
| Molecular formula | C10H8OS |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 2-thiophen-3-ylphenol |
| InChIKey | VCRSXSFOKOVCRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC=C2)O |
Computed by PubChem (NCBI)