CAS 29886-65-5 appears in our catalog under these names: 4-Thiophen-2-ylphenol, 98%, 4–(2–Thienyl)phenol, 4-(Thiophen-2-yl)phenol 98%, 4-(Thiophen-2-yl)phenol, 98%, 98%, 4-(2-Thienyl)phenol. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
4-thiophen-2-ylphenol (CAS 29886-65-5) is a chemical compound with the molecular formula C10H8OS and a molecular weight of 176.24 g/mol. IUPAC name: 4-thiophen-2-ylphenol. InChIKey: RUZWJMSQCFYNAM-UHFFFAOYSA-N.
| Molecular formula | C10H8OS |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 4-thiophen-2-ylphenol |
| InChIKey | RUZWJMSQCFYNAM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)