CAS 1128-88-7 appears in our catalog under these names: 5-Acetylbenzothiophene, 95%, 5-Acetylbenzothiophene, 1-(benzo[b]thiophen-5-yl)ethanone, 95%, 95%, 1-(BENZO[B]THIOPHEN-5-YL)ETHANONE, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg, 10g.
1-(1-benzothiophen-5-yl)ethanone (CAS 1128-88-7) is a chemical compound with the molecular formula C10H8OS and a molecular weight of 176.24 g/mol. IUPAC name: 1-(1-benzothiophen-5-yl)ethanone. InChIKey: LYPSYIWSZQVHAB-UHFFFAOYSA-N.
| Molecular formula | C10H8OS |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 1-(1-benzothiophen-5-yl)ethanone |
| InChIKey | LYPSYIWSZQVHAB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)SC=C2 |
Computed by PubChem (NCBI)