CAS 29886-66-6 appears in our catalog under these names: 3-(Thiophen-2-yl)phenol, 95%, 3-(Thiophen-2-yl)phenol, 97%, 3-(Thiophen-2-yl)phenol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
3-thiophen-2-ylphenol (CAS 29886-66-6) is a chemical compound with the molecular formula C10H8OS and a molecular weight of 176.24 g/mol. IUPAC name: 3-thiophen-2-ylphenol. InChIKey: JNRLPFAEBJQNQG-UHFFFAOYSA-N.
| Molecular formula | C10H8OS |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 3-thiophen-2-ylphenol |
| InChIKey | JNRLPFAEBJQNQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=CC=CS2 |
Computed by PubChem (NCBI)