Products 1089327-13-8

CAS 1089327-13-8 is the registry number for 2-Benzoxazolinone hydrate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100g, 1kg, 500g, 25g, 5g.

Structural formula: {0} (CAS {1})

3H-1,3-benzoxazol-2-one;hydrate (CAS 1089327-13-8) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3H-1,3-benzoxazol-2-one;hydrate. InChIKey: YOJMLQFFPIKVPF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO3
Molecular weight153.14 g/mol
IUPAC name3H-1,3-benzoxazol-2-one;hydrate
InChIKeyYOJMLQFFPIKVPF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)NC(=O)O2.O

Computed by PubChem (NCBI)