Products 1089616-08-9
CAS 1089616-08-9 is the registry number for N-(3-Ethynylphenyl)-4,5-dimethylthiophene-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-ethynylphenyl)-4,5-dimethylthiophene-2-carboxamide (CAS 1089616-08-9) is a chemical compound with the molecular formula C15H13NOS and a molecular weight of 255.3 g/mol. IUPAC name: N-(3-ethynylphenyl)-4,5-dimethylthiophene-2-carboxamide. InChIKey: WBYNKYUMXHFVIW-UHFFFAOYSA-N.
| Molecular formula | C15H13NOS |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | N-(3-ethynylphenyl)-4,5-dimethylthiophene-2-carboxamide |
| InChIKey | WBYNKYUMXHFVIW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)C(=O)NC2=CC=CC(=C2)C#C)C |
Computed by PubChem (NCBI)