CAS 29291-15-4 is the registry number for 2,3-Diphenylthiazolidin-4-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-diphenyl-1,3-thiazolidin-4-one (CAS 29291-15-4) is a chemical compound with the molecular formula C15H13NOS and a molecular weight of 255.3 g/mol. IUPAC name: 2,3-diphenyl-1,3-thiazolidin-4-one. InChIKey: DQIBOSWPDZUOKX-UHFFFAOYSA-N.
| Molecular formula | C15H13NOS |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 2,3-diphenyl-1,3-thiazolidin-4-one |
| InChIKey | DQIBOSWPDZUOKX-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(S1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)