CAS 119873-05-1 is the registry number for (S)-2-Phenyl-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 119873-05-1) is a chemical compound with the molecular formula C15H13NOS and a molecular weight of 255.3 g/mol. IUPAC name: (2S)-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: XIJZRXDBTDOULF-AWEZNQCLSA-N.
| Molecular formula | C15H13NOS |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | (2S)-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | XIJZRXDBTDOULF-AWEZNQCLSA-N |
| SMILES | C1[C@H](SC2=CC=CC=C2NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)