Products 848652-10-8
CAS 848652-10-8 is the registry number for 5-(2-methoxyphenyl)-2-methylbenzo(d)thiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
5-(2-methoxyphenyl)-2-methyl-1,3-benzothiazole (CAS 848652-10-8) is a chemical compound with the molecular formula C15H13NOS and a molecular weight of 255.3 g/mol. IUPAC name: 5-(2-methoxyphenyl)-2-methyl-1,3-benzothiazole. InChIKey: JMYFZPZCKHZFGO-UHFFFAOYSA-N.
| Molecular formula | C15H13NOS |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 5-(2-methoxyphenyl)-2-methyl-1,3-benzothiazole |
| InChIKey | JMYFZPZCKHZFGO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)C3=CC=CC=C3OC |
Computed by PubChem (NCBI)