CAS 108989-36-2 appears in our catalog under these names: 3,3'-Dibromo-4,4'-dimethoxybiphenyl, 95%, 3,3'–Dibromo–4,4'–dimethoxybiphenyl, 3,3'-Dibromo-4,4'-dimethoxybiphenyl, >93.0%(GC)(qNMR), 3,3'-Dibromo-4,4'-dimethoxybiphenyl 95%, 3,3'-Dibromo-4,4'-dimethoxybiphenyl, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 200mg, 100mg, 250mg.
2-bromo-4-(3-bromo-4-methoxyphenyl)-1-methoxybenzene (CAS 108989-36-2) is a chemical compound with the molecular formula C14H12Br2O2 and a molecular weight of 372.05 g/mol. IUPAC name: 2-bromo-4-(3-bromo-4-methoxyphenyl)-1-methoxybenzene. InChIKey: VUOOJGFHEDZGEA-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2O2 |
|---|---|
| Molecular weight | 372.05 g/mol |
| IUPAC name | 2-bromo-4-(3-bromo-4-methoxyphenyl)-1-methoxybenzene |
| InChIKey | VUOOJGFHEDZGEA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=C(C=C2)OC)Br)Br |
Computed by PubChem (NCBI)