CAS 56442-56-9 is the registry number for (2-(Benzyloxy)-3,5-dibromophenyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,5-dibromo-2-phenylmethoxyphenyl)methanol (CAS 56442-56-9) is a chemical compound with the molecular formula C14H12Br2O2 and a molecular weight of 372.05 g/mol. IUPAC name: (3,5-dibromo-2-phenylmethoxyphenyl)methanol. InChIKey: ANPFENCZVQQRDJ-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2O2 |
|---|---|
| Molecular weight | 372.05 g/mol |
| IUPAC name | (3,5-dibromo-2-phenylmethoxyphenyl)methanol |
| InChIKey | ANPFENCZVQQRDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)Br)CO |
Computed by PubChem (NCBI)