CAS 249515-07-9 appears in our catalog under these names: [4-(Benzyloxy)-3,5-dibromophenyl]methanol, 95%, (4-(Benzyloxy)-3,5-dibromophenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(3,5-dibromo-4-phenylmethoxyphenyl)methanol (CAS 249515-07-9) is a chemical compound with the molecular formula C14H12Br2O2 and a molecular weight of 372.05 g/mol. IUPAC name: (3,5-dibromo-4-phenylmethoxyphenyl)methanol. InChIKey: GONANTFRLMLXER-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2O2 |
|---|---|
| Molecular weight | 372.05 g/mol |
| IUPAC name | (3,5-dibromo-4-phenylmethoxyphenyl)methanol |
| InChIKey | GONANTFRLMLXER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)CO)Br |
Computed by PubChem (NCBI)