CAS 84530-63-2 is the registry number for 2,2'-Dibromo-4,4'-dimethoxy-1,1'-biphenyl, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(2-bromo-4-methoxyphenyl)-4-methoxybenzene (CAS 84530-63-2) is a chemical compound with the molecular formula C14H12Br2O2 and a molecular weight of 372.05 g/mol. IUPAC name: 2-bromo-1-(2-bromo-4-methoxyphenyl)-4-methoxybenzene. InChIKey: LJAHZCXRQBQPII-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2O2 |
|---|---|
| Molecular weight | 372.05 g/mol |
| IUPAC name | 2-bromo-1-(2-bromo-4-methoxyphenyl)-4-methoxybenzene |
| InChIKey | LJAHZCXRQBQPII-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=C(C=C(C=C2)OC)Br)Br |
Computed by PubChem (NCBI)