Products 1090436-55-7
CAS 1090436-55-7 is the registry number for N-(3-(2,4-Dichlorophenyl)propanoyl)-N-methylglycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[3-(2,4-dichlorophenyl)propanoylamino]acetate (CAS 1090436-55-7) is a chemical compound with the molecular formula C12H13Cl2NO3 and a molecular weight of 290.14 g/mol. IUPAC name: methyl 2-[3-(2,4-dichlorophenyl)propanoylamino]acetate. InChIKey: HPSZRPBCYSXIDY-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO3 |
|---|---|
| Molecular weight | 290.14 g/mol |
| IUPAC name | methyl 2-[3-(2,4-dichlorophenyl)propanoylamino]acetate |
| InChIKey | HPSZRPBCYSXIDY-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)CCC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)