Products 1099144-22-5

CAS 1099144-22-5 is the registry number for 4-(2-(2,6-Dichlorophenyl)acetamido)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[[2-(2,6-dichlorophenyl)acetyl]amino]butanoic acid (CAS 1099144-22-5) is a chemical compound with the molecular formula C12H13Cl2NO3 and a molecular weight of 290.14 g/mol. IUPAC name: 4-[[2-(2,6-dichlorophenyl)acetyl]amino]butanoic acid. InChIKey: OIUFZJZDXBDLEG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13Cl2NO3
Molecular weight290.14 g/mol
IUPAC name4-[[2-(2,6-dichlorophenyl)acetyl]amino]butanoic acid
InChIKeyOIUFZJZDXBDLEG-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)CC(=O)NCCCC(=O)O)Cl

Computed by PubChem (NCBI)