CAS 1099144-22-5 is the registry number for 4-(2-(2,6-Dichlorophenyl)acetamido)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[2-(2,6-dichlorophenyl)acetyl]amino]butanoic acid (CAS 1099144-22-5) is a chemical compound with the molecular formula C12H13Cl2NO3 and a molecular weight of 290.14 g/mol. IUPAC name: 4-[[2-(2,6-dichlorophenyl)acetyl]amino]butanoic acid. InChIKey: OIUFZJZDXBDLEG-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO3 |
|---|---|
| Molecular weight | 290.14 g/mol |
| IUPAC name | 4-[[2-(2,6-dichlorophenyl)acetyl]amino]butanoic acid |
| InChIKey | OIUFZJZDXBDLEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)NCCCC(=O)O)Cl |
Computed by PubChem (NCBI)