CAS 141627-49-8 appears in our catalog under these names: 2-[(2,4-Dichlorobenzoyl)amino]-3-methylbutanoic acid, 95%, 2-((2,4-Dichlorophenyl)formamido)-3-methylbutanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoic acid (CAS 141627-49-8) is a chemical compound with the molecular formula C12H13Cl2NO3 and a molecular weight of 290.14 g/mol. IUPAC name: 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoic acid. InChIKey: RSRQSHMLUDVDMC-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO3 |
|---|---|
| Molecular weight | 290.14 g/mol |
| IUPAC name | 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoic acid |
| InChIKey | RSRQSHMLUDVDMC-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)