CAS 1153114-90-9 appears in our catalog under these names: Methyl 2-(2-(2,4-dichlorophenyl)-N-methylacetamido)acetate, 95%, Methyl 2-(2-(2,4-dichlorophenyl)-N-methylacetamido)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
Methyl 2-[[2-(2,4-dichlorophenyl)acetyl]-methylamino]acetate (CAS 1153114-90-9) is a chemical compound with the molecular formula C12H13Cl2NO3 and a molecular weight of 290.14 g/mol. IUPAC name: methyl 2-[[2-(2,4-dichlorophenyl)acetyl]-methylamino]acetate. InChIKey: XJQKZOVHQDVIEI-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO3 |
|---|---|
| Molecular weight | 290.14 g/mol |
| IUPAC name | methyl 2-[[2-(2,4-dichlorophenyl)acetyl]-methylamino]acetate |
| InChIKey | XJQKZOVHQDVIEI-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)OC)C(=O)CC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)