Products 109060-66-4
CAS 109060-66-4 appears in our catalog under these names: 5-(3-Bromophenyl)-1,3,4-oxadiazol-2-amine, 96%, 5-(3-Bromophenyl)-1,3,4-oxadiazol-2-amine, 5-(3-Bromophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(3-Bromophenyl)-1,3,4-oxadiazol-2-amine, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 500mg, 2.5g.
5-(3-bromophenyl)-1,3,4-oxadiazol-2-amine (CAS 109060-66-4) is a chemical compound with the molecular formula C8H6BrN3O and a molecular weight of 240.06 g/mol. IUPAC name: 5-(3-bromophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: CVVNMXRTDJRCHC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | CVVNMXRTDJRCHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NN=C(O2)N |
Computed by PubChem (NCBI)