CAS 1090613-17-4 is the registry number for N-Isobutyl-2,5-dimethylthiophene-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dimethyl-N-(2-methylpropyl)thiophene-3-carboxamide (CAS 1090613-17-4) is a chemical compound with the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. IUPAC name: 2,5-dimethyl-N-(2-methylpropyl)thiophene-3-carboxamide. InChIKey: JECNHRLZEIZFHG-UHFFFAOYSA-N.
| Molecular formula | C11H17NOS |
|---|---|
| Molecular weight | 211.33 g/mol |
| IUPAC name | 2,5-dimethyl-N-(2-methylpropyl)thiophene-3-carboxamide |
| InChIKey | JECNHRLZEIZFHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)C(=O)NCC(C)C |
Computed by PubChem (NCBI)