CAS 1372133-78-2 is the registry number for (R)-N,2-Dimethyl-n-phenylpropane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(R)-N,2-dimethyl-N-phenylpropane-2-sulfinamide (CAS 1372133-78-2) is a chemical compound with the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. IUPAC name: (R)-N,2-dimethyl-N-phenylpropane-2-sulfinamide. InChIKey: IJDUIPHIFHJZKC-CQSZACIVSA-N.
| Molecular formula | C11H17NOS |
|---|---|
| Molecular weight | 211.33 g/mol |
| IUPAC name | (R)-N,2-dimethyl-N-phenylpropane-2-sulfinamide |
| InChIKey | IJDUIPHIFHJZKC-CQSZACIVSA-N |
| SMILES | CC(C)(C)[S@@](=O)N(C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)