Products 1372133-67-9
CAS 1372133-67-9 is the registry number for (R)-2-Methyl-n-(m-tolyl)propane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(R)-2-methyl-N-(3-methylphenyl)propane-2-sulfinamide (CAS 1372133-67-9) is a chemical compound with the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. IUPAC name: (R)-2-methyl-N-(3-methylphenyl)propane-2-sulfinamide. InChIKey: HXWRPRYPEZIYKL-CQSZACIVSA-N.
| Molecular formula | C11H17NOS |
|---|---|
| Molecular weight | 211.33 g/mol |
| IUPAC name | (R)-2-methyl-N-(3-methylphenyl)propane-2-sulfinamide |
| InChIKey | HXWRPRYPEZIYKL-CQSZACIVSA-N |
| SMILES | CC1=CC(=CC=C1)N[S@](=O)C(C)(C)C |
Computed by PubChem (NCBI)