Products 1372133-68-0
CAS 1372133-68-0 is the registry number for (R)-2-Methyl-n-(o-tolyl)propane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(R)-2-methyl-N-(2-methylphenyl)propane-2-sulfinamide (CAS 1372133-68-0) is a chemical compound with the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. IUPAC name: (R)-2-methyl-N-(2-methylphenyl)propane-2-sulfinamide. InChIKey: NGPAHFIJUIGWGS-CQSZACIVSA-N.
| Molecular formula | C11H17NOS |
|---|---|
| Molecular weight | 211.33 g/mol |
| IUPAC name | (R)-2-methyl-N-(2-methylphenyl)propane-2-sulfinamide |
| InChIKey | NGPAHFIJUIGWGS-CQSZACIVSA-N |
| SMILES | CC1=CC=CC=C1N[S@](=O)C(C)(C)C |
Computed by PubChem (NCBI)