Products 1090625-81-2
CAS 1090625-81-2 appears in our catalog under these names: 5-Chloroindole-2-carboxylic acid methyla, mide, 2 g, 5-Chloroindole-2-carboxylic acid methylamide, 5-Chloroindole-2-carboxylic acid methyla, mide, 1 g, 5-Chloroindole-2-carboxylic acid methyla, mide, 500 mg, 5-Chloroindole-2-carboxylic acid methyla, mide, 5 g. Offered by: Roth, Biosynth. Available pack sizes: 2g, 1g, 5g, 10g, 500mg.
5-chloro-N-methyl-1H-indole-2-carboxamide (CAS 1090625-81-2) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 5-chloro-N-methyl-1H-indole-2-carboxamide. InChIKey: BPFZXGAWSIZYJJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 5-chloro-N-methyl-1H-indole-2-carboxamide |
| InChIKey | BPFZXGAWSIZYJJ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC2=C(N1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)